Products 766557-02-2
CAS 766557-02-2 appears in our catalog under these names: 6-Chloro-1H-indole-3-carboxylic acid, 98%, 98%, 6-Chloroindole-3-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
6-chloro-1H-indole-3-carboxylic acid (CAS 766557-02-2) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 6-chloro-1H-indole-3-carboxylic acid. InChIKey: WHQHEMBHJZAHSB-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 6-chloro-1H-indole-3-carboxylic acid |
| InChIKey | WHQHEMBHJZAHSB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC=C2C(=O)O |
Computed by PubChem (NCBI)