Products 77415-70-4
CAS 77415-70-4 appears in our catalog under these names: 2,7-Diazaspiro[4.4]nonane-1,3,6,8-tetraone, 95%, 2,7-Diazaspiro(4.4)nonane-1,3,6,8-tetraone, 95+%, 2,7-Diazaspiro[4.4]nonane-1,3,6,8-tetraone, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2,7-diazaspiro[4.4]nonane-1,3,6,8-tetrone (CAS 77415-70-4) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 2,7-diazaspiro[4.4]nonane-1,3,6,8-tetrone. InChIKey: OHORDZQESMHPGG-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 2,7-diazaspiro[4.4]nonane-1,3,6,8-tetrone |
| InChIKey | OHORDZQESMHPGG-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC(=O)C12CC(=O)NC2=O |
Computed by PubChem (NCBI)