Products 78088-17-2
CAS 78088-17-2 is the registry number for 1,2,3,4-Tetra-O-acetyl-b-L-xylopyranose. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 25g, 10g.
[(3S,4R,5S,6R)-4,5,6-triacetyloxyoxan-3-yl] acetate (CAS 78088-17-2) is a chemical compound with the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. IUPAC name: [(3S,4R,5S,6R)-4,5,6-triacetyloxyoxan-3-yl] acetate. InChIKey: MJOQJPYNENPSSS-QNWHQSFQSA-N.
| Molecular formula | C13H18O9 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | [(3S,4R,5S,6R)-4,5,6-triacetyloxyoxan-3-yl] acetate |
| InChIKey | MJOQJPYNENPSSS-QNWHQSFQSA-N |
| SMILES | CC(=O)O[C@H]1CO[C@@H]([C@H]([C@@H]1OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)