CAS 79637-05-1 is the registry number for 1–Vinyl–3–benzyl imidazolium chlorine. Offered by: GLPBio. Available pack sizes: 1g, 5g.
1-benzyl-3-ethenylimidazol-1-ium chloride (CAS 79637-05-1) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 1-benzyl-3-ethenylimidazol-1-ium chloride. InChIKey: XIJLLXAKBJPLPE-UHFFFAOYSA-M.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 1-benzyl-3-ethenylimidazol-1-ium chloride |
| InChIKey | XIJLLXAKBJPLPE-UHFFFAOYSA-M |
| SMILES | C=CN1C=C[N+](=C1)CC2=CC=CC=C2.[Cl-] |
Computed by PubChem (NCBI)