CAS 352553-60-7 appears in our catalog under these names: 6-Chloro-2,3,4,9-tetrahydro-1h-carbazol-1-amine, 95%, 6-Chloro-2,3,4,9-tetrahydro-1H-carbazol-1-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 5g.
6-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-amine (CAS 352553-60-7) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 6-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-amine. InChIKey: BWLLTVHXDXVUIQ-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 6-chloro-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| InChIKey | BWLLTVHXDXVUIQ-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C3=C(N2)C=CC(=C3)Cl)N |
Computed by PubChem (NCBI)