CAS 1498333-87-1 appears in our catalog under these names: (4-(Pyridin-2-yl)phenyl)methanamine hydrochloride, 95%, (4-(Pyridin-2-yl)phenyl)methanamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 250mg, 10g, 1g, 100mg.
(4-pyridin-2-ylphenyl)methanamine;hydrochloride (CAS 1498333-87-1) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: (4-pyridin-2-ylphenyl)methanamine;hydrochloride. InChIKey: CIJJNYGBSSBMHU-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | (4-pyridin-2-ylphenyl)methanamine;hydrochloride |
| InChIKey | CIJJNYGBSSBMHU-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)