CAS 530-47-2 appears in our catalog under these names: 1,1-Diphenylhydrazine hydrochloride, 95%, 1,1-Diphenylhydrazine hydrochloride, 97%, 1,1–Diphenylhydrazine Hydrochloride, 1,1-Diphenylhydrazine hydrochloride, 98% , 1,1-Diphenylhydrazine Hydrochloride, >98.0%(HPLC)(T). Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 5g, 1g, 100g.
1,1-diphenylhydrazine;hydrochloride (CAS 530-47-2) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 1,1-diphenylhydrazine;hydrochloride. InChIKey: MIVUDWFNUOXEJM-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 1,1-diphenylhydrazine;hydrochloride |
| InChIKey | MIVUDWFNUOXEJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)