Products 63543-02-2
CAS 63543-02-2 appears in our catalog under these names: Biphenyl-4-yl-hydrazine hydrochloride, 95%, [1,1'-Biphenyl]-4-ylhydrazine hydrochloride, 97%, 97%, [1,1'-Biphenyl]-4-ylhydrazine hydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 2g.
(4-phenylphenyl)hydrazine;hydrochloride (CAS 63543-02-2) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: (4-phenylphenyl)hydrazine;hydrochloride. InChIKey: VQVHDZKZQXXRTH-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | (4-phenylphenyl)hydrazine;hydrochloride |
| InChIKey | VQVHDZKZQXXRTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NN.Cl |
Computed by PubChem (NCBI)
Synonyms:
Hydrazine, (4-biphenylyl)-, hydrochloride, [1,1'-Biphenyl]-4-ylhydrazine hydrochloride, (4-phenylphenyl)hydrazine;hydrochloride, 4-Biphenylylhydrazine hydrochloride, (4-phenylphenyl)hydrazine hydrochloride, 4-Biphenylylhydrazine, hydrochloride, Biphenyl-4-ylhydrazine hydrochloride, WLN: ZMR DR &GH, VQVHDZKZQXXRTH-UHFFFAOYSA-N, (4-phenylphenyl)hydrazine chloride