Products 2198-59-6
CAS 2198-59-6 appears in our catalog under these names: 4-Aminodiphenylamine hydrochloride, 96%, 4–Aminodiphenylamine Hydrochloride, 4-Aminodiphenylamine Hydrochloride, >98.0%(T), N1-Phenylbenzene-1,4-diamine hydrochloride, 97%, 97%, N1-Phenylbenzene-1,4-diamine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g.
4-N-phenylbenzene-1,4-diamine;hydrochloride (CAS 2198-59-6) is a chemical compound with the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. IUPAC name: 4-N-phenylbenzene-1,4-diamine;hydrochloride. InChIKey: PNEVDCGZQWFIKV-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2 |
|---|---|
| Molecular weight | 220.70 g/mol |
| IUPAC name | 4-N-phenylbenzene-1,4-diamine;hydrochloride |
| InChIKey | PNEVDCGZQWFIKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)