CAS 81721-87-1 appears in our catalog under these names: 6–Nitro–2H–1,4–benzoxazin–3(4H)–one, 6-Nitro-2H-1,4-benzoxazin-3(4H)-one, >98.0%(GC), 6-NITRO-2H-1,4-BENZOXAZIN-3(4H)-ONE, 97%, 6-Nitro-4H-benzo[1,4]oxazin-3-one, 98%, 98%, 6-Nitro-2H-1,4-benzoxazin-3(4H)-one, 98%. Offered by: GLPBio, TCI, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 100g.
6-nitro-4H-1,4-benzoxazin-3-one (CAS 81721-87-1) is a chemical compound with the molecular formula C8H6N2O4 and a molecular weight of 194.14 g/mol. IUPAC name: 6-nitro-4H-1,4-benzoxazin-3-one. InChIKey: UNYXDJBNODSRRC-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O4 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 6-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | UNYXDJBNODSRRC-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)