CAS 82362-93-4 is the registry number for 4,7–Dichlorocinnoline. Offered by: GLPBio. Available pack sizes: 50mg.
4,7-dichlorocinnoline (CAS 82362-93-4) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 4,7-dichlorocinnoline. InChIKey: NINQYOWDHNSQQS-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 4,7-dichlorocinnoline |
| InChIKey | NINQYOWDHNSQQS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=NC=C2Cl |
Computed by PubChem (NCBI)