CAS 84184-53-2 is the registry number for 3-(4-(Benzyloxy)phenyl)prop-2-enal. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(E)-3-(4-phenylmethoxyphenyl)prop-2-enal (CAS 84184-53-2) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: (E)-3-(4-phenylmethoxyphenyl)prop-2-enal. InChIKey: NYHQCCMTIODLDK-QPJJXVBHSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | (E)-3-(4-phenylmethoxyphenyl)prop-2-enal |
| InChIKey | NYHQCCMTIODLDK-QPJJXVBHSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)/C=C/C=O |
Computed by PubChem (NCBI)