CAS 852956-32-2 is the registry number for 1-(4-Methoxyphenyl)imidazolidine-2,4,5-trione. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
1-(4-methoxyphenyl)imidazolidine-2,4,5-trione (CAS 852956-32-2) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 1-(4-methoxyphenyl)imidazolidine-2,4,5-trione. InChIKey: RHSZIUTWVPFPQV-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)imidazolidine-2,4,5-trione |
| InChIKey | RHSZIUTWVPFPQV-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(=O)C(=O)NC2=O |
Computed by PubChem (NCBI)