CAS 853751-19-6 is the registry number for 8–((4–Methylbenzene)sulfonyl)–1,4–dioxa–8–azaspiro(4·5)decane. Offered by: GLPBio. Available pack sizes: 1g, 500mg.
8-(4-methylphenyl)sulfonyl-1,4-dioxa-8-azaspiro[4.5]decane (CAS 853751-19-6) is a chemical compound with the molecular formula C14H19NO4S and a molecular weight of 297.37 g/mol. IUPAC name: 8-(4-methylphenyl)sulfonyl-1,4-dioxa-8-azaspiro[4.5]decane. InChIKey: AIUOOZWKSYNHFG-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4S |
|---|---|
| Molecular weight | 297.37 g/mol |
| IUPAC name | 8-(4-methylphenyl)sulfonyl-1,4-dioxa-8-azaspiro[4.5]decane |
| InChIKey | AIUOOZWKSYNHFG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC3(CC2)OCCO3 |
Computed by PubChem (NCBI)