Products 858942-71-9
CAS 858942-71-9 is the registry number for 2-Hydroxy-8,9-dimethoxy-6H-isoindolo(2,1-a)indol-6-one. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
2-hydroxy-8,9-dimethoxyisoindolo[2,3-a]indol-6-one (CAS 858942-71-9) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: 2-hydroxy-8,9-dimethoxyisoindolo[2,3-a]indol-6-one. InChIKey: IRPIYZBBHNVOHO-UHFFFAOYSA-N.
| Molecular formula | C17H13NO4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 2-hydroxy-8,9-dimethoxyisoindolo[2,3-a]indol-6-one |
| InChIKey | IRPIYZBBHNVOHO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C3=CC4=C(N3C2=O)C=CC(=C4)O)OC |
Computed by PubChem (NCBI)