CAS 860205-48-7 appears in our catalog under these names: Hydroxychloroquine Impurity 28, 5-chloro-4-hydroxyquinoline-3-carboxylic acid. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 860205-48-7) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 5-chloro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: AZZUWFJILOYUGK-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 5-chloro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | AZZUWFJILOYUGK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=O)C(=CN2)C(=O)O |
Computed by PubChem (NCBI)