CAS 86045-82-1 is the registry number for 4-(Benzyloxy)-2,3-dihydro-1H-inden-1-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-phenylmethoxy-2,3-dihydroinden-1-one (CAS 86045-82-1) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 4-phenylmethoxy-2,3-dihydroinden-1-one. InChIKey: SHWDWAGEQXIWRK-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 4-phenylmethoxy-2,3-dihydroinden-1-one |
| InChIKey | SHWDWAGEQXIWRK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)