Products 86153-24-4
CAS 86153-24-4 appears in our catalog under these names: 7-Chloro-1h-indole-3-carboxylic acid, 95%, 7-Chloro-1H-indole-3-carboxylic acid, 97%, 7–Chloro–1H–Indole–3–Carboxylic Acid, 7-Chloro-1H-indole-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100mg, 250mg, 500mg, 10g, 100g.
7-chloro-1H-indole-3-carboxylic acid (CAS 86153-24-4) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 7-chloro-1H-indole-3-carboxylic acid. InChIKey: DBCJWTBYVXEBJY-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 7-chloro-1H-indole-3-carboxylic acid |
| InChIKey | DBCJWTBYVXEBJY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC=C2C(=O)O |
Computed by PubChem (NCBI)