Products 86360-62-5
CAS 86360-62-5 appears in our catalog under these names: 3,4-Dihydro-2H-1,4-thiazine-3,5-dicarboxylic acid, 98%, 98%, (R)-3,4-Dihydro-2H-1,4-thiazine-3,5-dicarboxylic acid, 98%. Offered by: Chemat, Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg.
3,4-dihydro-2H-1,4-thiazine-3,5-dicarboxylic acid (CAS 86360-62-5) is a chemical compound with the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. IUPAC name: 3,4-dihydro-2H-1,4-thiazine-3,5-dicarboxylic acid. InChIKey: PKFNRZOFABOFSP-UHFFFAOYSA-N.
| Molecular formula | C6H7NO4S |
|---|---|
| Molecular weight | 189.19 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,4-thiazine-3,5-dicarboxylic acid |
| InChIKey | PKFNRZOFABOFSP-UHFFFAOYSA-N |
| SMILES | C1C(NC(=CS1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)