CAS 869467-25-4 is the registry number for 5-Phenylisothiazolidin-3-one 1,1-dioxide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1,1-dioxo-5-phenyl-1,2-thiazolidin-3-one (CAS 869467-25-4) is a chemical compound with the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. IUPAC name: 1,1-dioxo-5-phenyl-1,2-thiazolidin-3-one. InChIKey: UYQRVATUDIMDJN-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | 1,1-dioxo-5-phenyl-1,2-thiazolidin-3-one |
| InChIKey | UYQRVATUDIMDJN-UHFFFAOYSA-N |
| SMILES | C1C(S(=O)(=O)NC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)