Products 870150-57-5
CAS 870150-57-5 is the registry number for 2-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-6-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methylbenzoic acid (CAS 870150-57-5) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methylbenzoic acid. InChIKey: GXUAWDMYWAUCOJ-UHFFFAOYSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-methylbenzoic acid |
| InChIKey | GXUAWDMYWAUCOJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)