Products 871254-69-2
CAS 871254-69-2 appears in our catalog under these names: 2,3-Dichloro-4-(trifluoromethyl)benzoic acid, 2,3-Dichloro-4-(trifluoromethyl)benzoic acid, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg.
2,3-dichloro-4-(trifluoromethyl)benzoic acid (CAS 871254-69-2) is a chemical compound with the molecular formula C8H3Cl2F3O2 and a molecular weight of 259.01 g/mol. IUPAC name: 2,3-dichloro-4-(trifluoromethyl)benzoic acid. InChIKey: SXZBNNYNKIHGMD-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O2 |
|---|---|
| Molecular weight | 259.01 g/mol |
| IUPAC name | 2,3-dichloro-4-(trifluoromethyl)benzoic acid |
| InChIKey | SXZBNNYNKIHGMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)