CAS 872277-84-4 appears in our catalog under these names: 2-Hydroxy-3,5-dimethylbenzene-1-sulfonyl chloride, 95%, 2-Hydroxy-3,5-dimethylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-hydroxy-3,5-dimethylbenzenesulfonyl chloride (CAS 872277-84-4) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride. InChIKey: VDCHDSXNEUWUGQ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 2-hydroxy-3,5-dimethylbenzenesulfonyl chloride |
| InChIKey | VDCHDSXNEUWUGQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)S(=O)(=O)Cl)O)C |
Computed by PubChem (NCBI)