CAS 873967-47-6 is the registry number for 1,7-Dichlorophthalazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,7-dichlorophthalazine (CAS 873967-47-6) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 1,7-dichlorophthalazine. InChIKey: QJFRQKOTSCCLPL-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 1,7-dichlorophthalazine |
| InChIKey | QJFRQKOTSCCLPL-UHFFFAOYSA-N |
| SMILES | C1=CC2=CN=NC(=C2C=C1Cl)Cl |
Computed by PubChem (NCBI)