Products 875305-77-4
CAS 875305-77-4 appears in our catalog under these names: 4–Chloro–1H–indole–7–carboxylic acid, 4-Chloro-1H-indole-7-carboxylic acid, 4-Chloro-1H-indole-7-carboxylic acid 95%, 4-Chloro-1H-indole-7-carboxylic acid, 98%, 4-Chloro-1H-indole-7-carboxylic acid, 95%, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 2,5g, 1g, 5g.
4-chloro-1H-indole-7-carboxylic acid (CAS 875305-77-4) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 4-chloro-1H-indole-7-carboxylic acid. InChIKey: FSSABPRCBJORSR-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 4-chloro-1H-indole-7-carboxylic acid |
| InChIKey | FSSABPRCBJORSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CNC2=C1C(=O)O)Cl |
Computed by PubChem (NCBI)