CAS 875847-01-1 is the registry number for 2-Methyl-2,3-dihydro-4H-benzo[e][1,3]thiazin-4-one 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-1,1-dioxo-2,3-dihydro-1lambda6,3-benzothiazin-4-one (CAS 875847-01-1) is a chemical compound with the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. IUPAC name: 2-methyl-1,1-dioxo-2,3-dihydro-1lambda6,3-benzothiazin-4-one. InChIKey: NNFOFXPRNGIIFZ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3S |
|---|---|
| Molecular weight | 211.24 g/mol |
| IUPAC name | 2-methyl-1,1-dioxo-2,3-dihydro-1lambda6,3-benzothiazin-4-one |
| InChIKey | NNFOFXPRNGIIFZ-UHFFFAOYSA-N |
| SMILES | CC1NC(=O)C2=CC=CC=C2S1(=O)=O |
Computed by PubChem (NCBI)