CAS 878160-15-7 appears in our catalog under these names: 7–Methoxy–6–nitro–2H–benzo(b)(1,4)oxazin–3(4H)–one, 7-Methoxy-6-nitro-2H-1,4-benzoxazin-3(4H)-one, 98%, 98%, 7-Methoxy-6-nitro-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
7-methoxy-6-nitro-4H-1,4-benzoxazin-3-one (CAS 878160-15-7) is a chemical compound with the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. IUPAC name: 7-methoxy-6-nitro-4H-1,4-benzoxazin-3-one. InChIKey: CXLKAEISRXXRII-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O5 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 7-methoxy-6-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | CXLKAEISRXXRII-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)OCC(=O)N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)