Products 879067-92-2
CAS 879067-92-2 is the registry number for 8-Chloro-2-hydroxyquinoline-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-2-oxo-1H-quinoline-3-carboxylic acid (CAS 879067-92-2) is a chemical compound with the molecular formula C10H6ClNO3 and a molecular weight of 223.61 g/mol. IUPAC name: 8-chloro-2-oxo-1H-quinoline-3-carboxylic acid. InChIKey: WWBKUNAAULHLNW-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO3 |
|---|---|
| Molecular weight | 223.61 g/mol |
| IUPAC name | 8-chloro-2-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | WWBKUNAAULHLNW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC(=O)C(=C2)C(=O)O |
Computed by PubChem (NCBI)