Products 879067-97-7
CAS 879067-97-7 is the registry number for 7,8-Dichloro-2-oxo-1,2-dihydroquinoline-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7,8-dichloro-2-oxo-1H-quinoline-3-carboxylic acid (CAS 879067-97-7) is a chemical compound with the molecular formula C10H5Cl2NO3 and a molecular weight of 258.05 g/mol. IUPAC name: 7,8-dichloro-2-oxo-1H-quinoline-3-carboxylic acid. InChIKey: SNWITFJWLGZVIU-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO3 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 7,8-dichloro-2-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | SNWITFJWLGZVIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=C(C(=O)N2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)