CAS 88407-29-8 is the registry number for Tolterodine Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
7-methyl-4-phenyl-3,4-dihydrochromen-2-one (CAS 88407-29-8) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 7-methyl-4-phenyl-3,4-dihydrochromen-2-one. InChIKey: DVIONHZDAYXRBA-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 7-methyl-4-phenyl-3,4-dihydrochromen-2-one |
| InChIKey | DVIONHZDAYXRBA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(CC(=O)O2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)