Products 89239-22-5
CAS 89239-22-5 is the registry number for 7-Chloro-1,3,5-trimethyl-1H-pyrazolo(4,3-d)pyrimidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-chloro-1,3,5-trimethylpyrazolo[4,5-d]pyrimidine (CAS 89239-22-5) is a chemical compound with the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. IUPAC name: 7-chloro-1,3,5-trimethylpyrazolo[4,5-d]pyrimidine. InChIKey: BWESROVLRYCPEU-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4 |
|---|---|
| Molecular weight | 196.64 g/mol |
| IUPAC name | 7-chloro-1,3,5-trimethylpyrazolo[4,5-d]pyrimidine |
| InChIKey | BWESROVLRYCPEU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1N=C(N=C2Cl)C)C |
Computed by PubChem (NCBI)