CAS 892878-63-6 appears in our catalog under these names: Fmoc-4-amino-3-methylbenzoic Acid, 4-{((9H-Fluoren-9-ylmethoxy)carbonyl)amino}-3-methylbenzoic acid, Fmoc-4-amino-3-methylbenzoic acid 97%, 4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-methylbenzoic acid, 95%, 95%, FMOC-4-AMINO-3-METHYLBENZOIC ACID, 95%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 2,5g, 1g, 100mg.
4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbenzoic acid (CAS 892878-63-6) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbenzoic acid. InChIKey: AEMDMIXDWRNKND-UHFFFAOYSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbenzoic acid |
| InChIKey | AEMDMIXDWRNKND-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)