CAS 923175-13-7 appears in our catalog under these names: 2-Chloro-N-(2-methanesulfonylphenyl)acetamide, 95%, 2-Chloro-N-(2-methanesulfonylphenyl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-chloro-N-(2-methylsulfonylphenyl)acetamide (CAS 923175-13-7) is a chemical compound with the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. IUPAC name: 2-chloro-N-(2-methylsulfonylphenyl)acetamide. InChIKey: BTWKDNCQOZHSLW-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3S |
|---|---|
| Molecular weight | 247.70 g/mol |
| IUPAC name | 2-chloro-N-(2-methylsulfonylphenyl)acetamide |
| InChIKey | BTWKDNCQOZHSLW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC=C1NC(=O)CCl |
Computed by PubChem (NCBI)