CAS 927801-13-6 appears in our catalog under these names: 4,6–Dibromoquinoline, 4,6-Dibromoquinoline 95%, 4,6-Dibromoquinoline, 95%, 95%, 4,6-Dibromoquinoline, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
4,6-dibromoquinoline (CAS 927801-13-6) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 4,6-dibromoquinoline. InChIKey: SUCNDCRRXDSYHB-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 4,6-dibromoquinoline |
| InChIKey | SUCNDCRRXDSYHB-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CC(=C2C=C1Br)Br |
Computed by PubChem (NCBI)