CAS 928627-13-8 appears in our catalog under these names: 2,7-Dichloro-8-methoxyquinoline, 97%, 2,7-Dichloro-8-methoxyquinoline, 97%, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2,7-dichloro-8-methoxyquinoline (CAS 928627-13-8) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 2,7-dichloro-8-methoxyquinoline. InChIKey: BTKKTMLEWXMKDB-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 2,7-dichloro-8-methoxyquinoline |
| InChIKey | BTKKTMLEWXMKDB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC2=C1N=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)