Products 94107-60-5
CAS 94107-60-5 appears in our catalog under these names: 6-Nitro-2,4-dihydro-1H-3,1-benzoxazin-2-one, 6-Nitro-1,4-dihydro-2H-benzo[d][1,3]oxazin-2-one, 97%, 6-Nitro-1,4-dihydro-2H-benzo[d][1,3]oxazin-2-one, 98%, 1,4-dihydro-6-nitro-2H-3,1-benzoxazin-2-one, 98%. Offered by: Biosynth, Ambeed, Fluorochem, BLDpharm, Chemat. Available pack sizes: 0,5g, 5g, 250mg, 1g, 100mg, 10g.
6-nitro-1,4-dihydro-3,1-benzoxazin-2-one (CAS 94107-60-5) is a chemical compound with the molecular formula C8H6N2O4 and a molecular weight of 194.14 g/mol. IUPAC name: 6-nitro-1,4-dihydro-3,1-benzoxazin-2-one. InChIKey: NLLUNRCIKRPYMQ-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O4 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 6-nitro-1,4-dihydro-3,1-benzoxazin-2-one |
| InChIKey | NLLUNRCIKRPYMQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)[N+](=O)[O-])NC(=O)O1 |
Computed by PubChem (NCBI)