Products 945244-08-6
CAS 945244-08-6 appears in our catalog under these names: 2-(7-Chlorobenzo(d)(1,3)dioxol-5-yl)acetonitrile, 97%, 2-(7-Chloro-1,3-dioxaindan-5-yl)acetonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(7-chloro-1,3-benzodioxol-5-yl)acetonitrile (CAS 945244-08-6) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 2-(7-chloro-1,3-benzodioxol-5-yl)acetonitrile. InChIKey: PXUBPCCTTIRYOV-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 2-(7-chloro-1,3-benzodioxol-5-yl)acetonitrile |
| InChIKey | PXUBPCCTTIRYOV-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)CC#N)Cl |
Computed by PubChem (NCBI)