Products 952138-13-5
CAS 952138-13-5 appears in our catalog under these names: 4,7-Dichloro-1,6-naphthyridine 97%, 4，7-Dichloro-1，6-naphthyridine, 97%, 97%, 4,7-Dichloro-1,6-naphthyridine, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,7-dichloro-1,6-naphthyridine (CAS 952138-13-5) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 4,7-dichloro-1,6-naphthyridine. InChIKey: JGOTXCGNCXEAAY-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 4,7-dichloro-1,6-naphthyridine |
| InChIKey | JGOTXCGNCXEAAY-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C(N=CC2=C1Cl)Cl |
Computed by PubChem (NCBI)