CAS 98434-06-1 appears in our catalog under these names: 5–(2–Furyl)isoxazole–3–carboxylic Acid, 5-(Furan-2-yl)isoxazole-3-carboxylic acid, 98%, 98%, 5-Furan-2-yl-isoxazole-3-carboxylic acid, 98%, 5-(Furan-2-yl)isoxazole-3-carboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg, 25g.
5-(furan-2-yl)-1,2-oxazole-3-carboxylic acid (CAS 98434-06-1) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 5-(furan-2-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: MLWFYCMVBAIITM-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 5-(furan-2-yl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | MLWFYCMVBAIITM-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)