Products 98592-35-9
CAS 98592-35-9 appears in our catalog under these names: 2-(Chloromethyl)-4h-3,1-benzoxazin-4-one, 95%, 2-(Chloromethyl)-4H-benzo(d)(1,3)oxazin-4-one, 95+%, 2-(Chloromethyl)-4H-3,1-benzoxazin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-(chloromethyl)-3,1-benzoxazin-4-one (CAS 98592-35-9) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 2-(chloromethyl)-3,1-benzoxazin-4-one. InChIKey: KKLTUGCIQRSGAH-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 2-(chloromethyl)-3,1-benzoxazin-4-one |
| InChIKey | KKLTUGCIQRSGAH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC(=N2)CCl |
Computed by PubChem (NCBI)