Products 207981-48-4
CAS 207981-48-4 appears in our catalog under these names: 2,3-Difluorocinnamic acid, 96%, 3-(2,3-Difluorophenyl)acrylic acid, 95%, 2,3-Difluorocinnamic acid, 98% (mixture of isomers), 98% (mixture of isomers), trans-2,3-Difluorocinnamic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 100mg, 250mg.
3-(2,3-difluorophenyl)prop-2-enoic acid (CAS 207981-48-4) is a chemical compound with the molecular formula C9H6F2O2 and a molecular weight of 184.14 g/mol. IUPAC name: 3-(2,3-difluorophenyl)prop-2-enoic acid. InChIKey: NVQHKPLMLCHFSU-UHFFFAOYSA-N.
| Molecular formula | C9H6F2O2 |
|---|---|
| Molecular weight | 184.14 g/mol |
| IUPAC name | 3-(2,3-difluorophenyl)prop-2-enoic acid |
| InChIKey | NVQHKPLMLCHFSU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C=CC(=O)O |
Computed by PubChem (NCBI)