cas: 17026-42-5 — see every product listed under this CAS number, including other names
(+)-Dibenzoyl-D-tartaric acid, 98+% (CAS 17026-42-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 302510250 |
| cas | 17026-42-5 |
| size | 25g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 25g | 158.58 Pln | |
| Thermo Scientific (Acros) | 100g | 449.90 Pln | |
| Thermo Scientific (Acros) | 500g | 1403.15 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98+% |
(2S,3S)-2,3-dibenzoyloxybutanedioic acid (CAS 17026-42-5) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: (2S,3S)-2,3-dibenzoyloxybutanedioic acid. InChIKey: YONLFQNRGZXBBF-KBPBESRZSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | (2S,3S)-2,3-dibenzoyloxybutanedioic acid |
| InChIKey | YONLFQNRGZXBBF-KBPBESRZSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)O[C@@H]([C@@H](C(=O)O)OC(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)