cas: 17026-42-5 — see every product listed under this CAS number, including other names
(+)-Dibenzoyl-D-tartaric acid, 99.93% (CAS 17026-42-5) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 250 g, 10mM/1mL, 50 g, 500 g, 100 g, 1000 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-20551-25 g |
| cas | 17026-42-5 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 240.74 Pln | |
| MedChemExpress | 250 g | 640.13 Pln | |
| MedChemExpress | 10mM/1mL | 250.03 Pln | |
| MedChemExpress | 50 g | 310.40 Pln | |
| MedChemExpress | 500 g | 886.26 Pln | |
| MedChemExpress | 100 g | 407.93 Pln | |
| MedChemExpress | 1000 g | 1271.71 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.93% |
(2S,3S)-2,3-dibenzoyloxybutanedioic acid (CAS 17026-42-5) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: (2S,3S)-2,3-dibenzoyloxybutanedioic acid. InChIKey: YONLFQNRGZXBBF-KBPBESRZSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | (2S,3S)-2,3-dibenzoyloxybutanedioic acid |
| InChIKey | YONLFQNRGZXBBF-KBPBESRZSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)O[C@@H]([C@@H](C(=O)O)OC(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)