cas: 17026-42-5 — see every product listed under this CAS number, including other names
(+)-Dibenzoyl-D-tartaric acid, 99% (CAS 17026-42-5) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1509139-500g |
| cas | 17026-42-5 |
| size | 500g |
| availability | USA Stock: 29400g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 500g | 244.99 Pln | |
| AmBeed | 100g | 174.16 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
(2S,3S)-2,3-dibenzoyloxybutanedioic acid (CAS 17026-42-5) is a chemical compound with the molecular formula C18H14O8 and a molecular weight of 358.3 g/mol. IUPAC name: (2S,3S)-2,3-dibenzoyloxybutanedioic acid. InChIKey: YONLFQNRGZXBBF-KBPBESRZSA-N.
| Molecular formula | C18H14O8 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | (2S,3S)-2,3-dibenzoyloxybutanedioic acid |
| InChIKey | YONLFQNRGZXBBF-KBPBESRZSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)O[C@@H]([C@@H](C(=O)O)OC(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)