cas: 21963-41-7 — see every product listed under this CAS number, including other names
(1S,2S)-Cyclohexane-1,2-dicarboxylic acid 95% (CAS 21963-41-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A235696-5g |
| cas | 21963-41-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 715.25 Pln | |
| Ambeed | 500g | 2634.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A235696 |
Trans-(1S,2S)-cyclohexane-1,2-dicarboxylic acid (CAS 21963-41-7) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: trans-(1S,2S)-cyclohexane-1,2-dicarboxylic acid. InChIKey: QSAWQNUELGIYBC-WDSKDSINSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | trans-(1S,2S)-cyclohexane-1,2-dicarboxylic acid |
| InChIKey | QSAWQNUELGIYBC-WDSKDSINSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)