CAS 870718-06-2 appears in our catalog under these names: 2,4-Difluoro-3-formylphenylboronic acid, 2,4–Difluoro–3–formylphenylboronic acid (contains varying amounts of Anhydride), 2,4-Difluoro-3-formylphenylboronic acid, 95%, 95%, (2,4-Difluoro-3-formylphenyl)boronic acid, 97%. Offered by: TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
(2,4-difluoro-3-formylphenyl)boronic acid (CAS 870718-06-2) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (2,4-difluoro-3-formylphenyl)boronic acid. InChIKey: PVAWONNALJEQJH-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O3 |
|---|---|
| Molecular weight | 185.92 g/mol |
| IUPAC name | (2,4-difluoro-3-formylphenyl)boronic acid |
| InChIKey | PVAWONNALJEQJH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)C=O)F)(O)O |
Computed by PubChem (NCBI)