Products 871125-93-8
CAS 871125-93-8 appears in our catalog under these names: (2，6–Difluoro–4–formylphenyl)boronic acid, (2,6-Difluoro-4-formylphenyl)boronic acid 98%, (2,6-Difluoro-4-formylphenyl)boronic acid, 97%, 97%, (2,6-Difluoro-4-formylphenyl)boronic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
(2,6-difluoro-4-formylphenyl)boronic acid (CAS 871125-93-8) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (2,6-difluoro-4-formylphenyl)boronic acid. InChIKey: NQBHBNIZBDDDRH-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O3 |
|---|---|
| Molecular weight | 185.92 g/mol |
| IUPAC name | (2,6-difluoro-4-formylphenyl)boronic acid |
| InChIKey | NQBHBNIZBDDDRH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)C=O)F)(O)O |
Computed by PubChem (NCBI)