CAS 870718-11-9 appears in our catalog under these names: 3,5–Difluoro–4–formylphenylboronic acid(contains varying amounts of Anhydride), (3,5-Difluoro-4-formylphenyl)boronic acid 95%, (3,5-Difluoro-4-formylphenyl)boronic acid, 95%, 95%, (3,5-Difluoro-4-formylphenyl)boronic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
(3,5-difluoro-4-formylphenyl)boronic acid (CAS 870718-11-9) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (3,5-difluoro-4-formylphenyl)boronic acid. InChIKey: XWZOKATWICIEMU-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O3 |
|---|---|
| Molecular weight | 185.92 g/mol |
| IUPAC name | (3,5-difluoro-4-formylphenyl)boronic acid |
| InChIKey | XWZOKATWICIEMU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)C=O)F)(O)O |
Computed by PubChem (NCBI)