(2,5-Difluoro-4-formylphenyl)boronic acid, 95%
cas: 1228828-19-0 — see every product listed under this CAS number, including other names
(2,5-Difluoro-4-formylphenyl)boronic acid, 95% (CAS 1228828-19-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F694127-100MG |
| cas | 1228828-19-0 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 351.98 Pln | |
| Fluorochem | 250mg | 539.41 Pln | |
| Fluorochem | 1g | 1247.50 Pln | |
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 642.94 Pln | |
| Ambeed | 5g | 1783.25 Pln | |
| BLDpharm | 100mg | 281.04 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 686.45 Pln | |
| BLDpharm | 5g | 1919.35 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(2,5-difluoro-4-formylphenyl)boronic acid (CAS 1228828-19-0) is a chemical compound with the molecular formula C7H5BF2O3 and a molecular weight of 185.92 g/mol. IUPAC name: (2,5-difluoro-4-formylphenyl)boronic acid. InChIKey: LTCTYEAWYWPJQG-UHFFFAOYSA-N.
| Molecular formula | C7H5BF2O3 |
|---|---|
| Molecular weight | 185.92 g/mol |
| IUPAC name | (2,5-difluoro-4-formylphenyl)boronic acid |
| InChIKey | LTCTYEAWYWPJQG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)C=O)F)(O)O |
Computed by PubChem (NCBI)