cas: 1229584-22-8 — see every product listed under this CAS number, including other names
(2,5-Difluoro-4-hydroxyphenyl)boronic acid, 97% (CAS 1229584-22-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A177145-10g |
| cas | 1229584-22-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 24443.44 Pln | |
| AmBeed | 5g | 14372.47 Pln | |
| AmBeed | 25g | 47970.58 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2,5-difluoro-4-hydroxyphenyl)boronic acid (CAS 1229584-22-8) is a chemical compound with the molecular formula C6H5BF2O3 and a molecular weight of 173.91 g/mol. IUPAC name: (2,5-difluoro-4-hydroxyphenyl)boronic acid. InChIKey: BKSUWYUPEDFFDX-UHFFFAOYSA-N.
| Molecular formula | C6H5BF2O3 |
|---|---|
| Molecular weight | 173.91 g/mol |
| IUPAC name | (2,5-difluoro-4-hydroxyphenyl)boronic acid |
| InChIKey | BKSUWYUPEDFFDX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)O)F)(O)O |
Computed by PubChem (NCBI)